C20H19ClN4O2 — CID 136720557
1-[(3R)-5-(1H-benzimidazol-2-yl)-3-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-3-chloropropan-1-one (PubChem CID 136720557) has the molecular formula C20H19ClN4O2 and a molecular weight of 382.85 g/mol. Its IUPAC name is 1-[(3R)-5-(1H-benzimidazol-2-yl)-3-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-3-chloropropan-1-one.
| Compound Name | 1-[(3R)-5-(1H-benzimidazol-2-yl)-3-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-3-chloropropan-1-one |
|---|---|
| PubChem CID | 136720557 |
| Molecular Formula | C20H19ClN4O2 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1-[(3R)-5-(1H-benzimidazol-2-yl)-3-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-3-chloropropan-1-one |
| SMILES | COc1ccc([C@H]2CC(c3nc4ccccc4[nH]3)=NN2C(=O)CCCl)cc1 |
| InChI | InChI=1S/C20H19ClN4O2/c1-27-14-8-6-13(7-9-14)18-12-17(24-25(18)19(26)10-11-21)20-22-15-4-2-3-5-16(15)23-20/h2-9,18H,10-12H2,1H3,(H,22,23)/t18-/m1/s1 |
| InChIKey | JUQHOSQYJIRTCM-GOSISDBHSA-N |
| XLogP | 3.88 |
| TPSA | 70.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|