C19H22N2O6 — CID 136721055
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-[(2-hydroxy-5-methylphenyl)diazenyl]phenyl]oxane-3,4,5-triol (PubChem CID 136721055) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-[(2-hydroxy-5-methylphenyl)diazenyl]phenyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-[(2-hydroxy-5-methylphenyl)diazenyl]phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 136721055 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-[(2-hydroxy-5-methylphenyl)diazenyl]phenyl]oxane-3,4,5-triol |
| SMILES | Cc1ccc(O)c(/N=N/c2ccc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2)c1 |
| InChI | InChI=1S/C19H22N2O6/c1-10-2-7-14(23)13(8-10)21-20-12-5-3-11(4-6-12)19-18(26)17(25)16(24)15(9-22)27-19/h2-8,15-19,22-26H,9H2,1H3/b21-20+/t15-,16-,17+,18-,19+/m1/s1 |
| InChIKey | HPWMVANQGYQWFO-QKIZPOPRSA-N |
| XLogP | 1.63 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|