C49H37N5 — CID 136721398
2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene-24-carbonitrile (PubChem CID 136721398) has the molecular formula C49H37N5 and a molecular weight of 695.87 g/mol. Its IUPAC name is 2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene-24-carbonitrile.
| Compound Name | 2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene-24-carbonitrile |
|---|---|
| PubChem CID | 136721398 |
| Molecular Formula | C49H37N5 |
| Molecular Weight | 695.87 g/mol |
| Exact Mass | 695.30 |
| IUPAC Name | 2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene-24-carbonitrile |
| SMILES | Cc1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(C)cc3)=c3/cc/c([nH]3)=C(\c3ccc(C)cc3)C3=N/C(=C(/c4ccc(C)cc4)C4=NC=C2C4C#N)C=C3)cc1 |
| InChI | InChI=1S/C49H37N5/c1-29-5-13-33(14-6-29)45-38-28-51-49(37(38)27-50)48(36-19-11-32(4)12-20-36)44-26-25-43(54-44)47(35-17-9-31(3)10-18-35)42-24-23-41(53-42)46(40-22-21-39(45)52-40)34-15-7-30(2)8-16-34/h5-26,28,37,53H,1-4H3/b45-38-,45-39-,46-40-,46-41-,47-42-,47-43-,48-44-,49-48+ |
| InChIKey | LWWVSVBHWKPLAA-LYRNQNCTSA-N |
| XLogP | 8.98 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.87 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |