C19H31N3O3 — CID 136722497
2-tert-butyl-4-methyl-N-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 136722497) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is 2-tert-butyl-4-methyl-N-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-tert-butyl-4-methyl-N-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136722497 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 2-tert-butyl-4-methyl-N-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | Cc1nc(C(C)(C)C)[nH]c(=O)c1C(=O)NCCO[C@@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C19H31N3O3/c1-12-8-6-7-9-14(12)25-11-10-20-16(23)15-13(2)21-18(19(3,4)5)22-17(15)24/h12,14H,6-11H2,1-5H3,(H,20,23)(H,21,22,24)/t12-,14+/m0/s1 |
| InChIKey | MJRCAFBTRVFPLQ-GXTWGEPZSA-N |
| XLogP | 2.70 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|