About CID 136722626
CID 136722626 (PubChem CID 136722626) has the molecular formula C13H26Si4
and a molecular weight of 294.69 g/mol.
Molecular Properties
| Compound Name | CID 136722626 |
| PubChem CID | 136722626 |
| Molecular Formula | C13H26Si4 |
| Molecular Weight | 294.69 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | — |
| SMILES | C[Si](C)[Si](C)(C)[Si](C)(c1ccccc1)[Si](C)C |
| InChI | InChI=1S/C13H26Si4/c1-14(2)16(5,6)17(7,15(3)4)13-11-9-8-10-12-13/h8-12H,1-7H3 |
| InChIKey | KUVAAVAHOTWKNO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.69 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136722626 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136722626?
The IUPAC name of CID 136722626 (CID 136722626) is not available.
What is the SMILES notation for CID 136722626?
The canonical SMILES for CID 136722626 is C[Si](C)[Si](C)(C)[Si](C)(c1ccccc1)[Si](C)C.
What is the InChIKey of CID 136722626?
The InChIKey is KUVAAVAHOTWKNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26Si4/c1-14(2)16(5,6)17(7,15(3)4)13-11-9-8-10-12-13/h8-12H,1-7H3.
What are the key properties of CID 136722626?
CID 136722626 has a molecular weight of 294.69 g/mol, XLogP of 3.42, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136722626 is sourced from PubChem (CID 136722626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).