C22H24N4O2 — CID 136724449
1-(4-butylphenyl)-5-imino-4-(6-methoxy-1H-benzimidazol-2-yl)-2H-pyrrol-3-ol (PubChem CID 136724449) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-(4-butylphenyl)-5-imino-4-(6-methoxy-1H-benzimidazol-2-yl)-2H-pyrrol-3-ol.
| Compound Name | 1-(4-butylphenyl)-5-imino-4-(6-methoxy-1H-benzimidazol-2-yl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136724449 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 1-(4-butylphenyl)-5-imino-4-(6-methoxy-1H-benzimidazol-2-yl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3ccc(OC)cc3[nH]2)=C(O)CN1c1ccc(CCCC)cc1 |
| InChI | InChI=1S/C22H24N4O2/c1-3-4-5-14-6-8-15(9-7-14)26-13-19(27)20(21(26)23)22-24-17-11-10-16(28-2)12-18(17)25-22/h6-12,23,27H,3-5,13H2,1-2H3,(H,24,25)/b23-21- |
| InChIKey | YJVPTWAYIKQTDJ-LNVKXUELSA-N |
| XLogP | 4.68 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|