About 8-oxo-7H-[1,3]thiazolo[4,5-g]quinazoline-2-carbonitrile
8-oxo-7H-[1,3]thiazolo[4,5-g]quinazoline-2-carbonitrile (PubChem CID 136726272) has the molecular formula C10H4N4OS
and a molecular weight of 228.24 g/mol. Its IUPAC name is 8-oxo-7H-[1,3]thiazolo[4,5-g]quinazoline-2-carbonitrile.
Molecular Properties
| Compound Name | 8-oxo-7H-[1,3]thiazolo[4,5-g]quinazoline-2-carbonitrile |
| PubChem CID | 136726272 |
| Molecular Formula | C10H4N4OS |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 8-oxo-7H-[1,3]thiazolo[4,5-g]quinazoline-2-carbonitrile |
| SMILES | N#Cc1nc2cc3c(=O)[nH]cnc3cc2s1 |
| InChI | InChI=1S/C10H4N4OS/c11-3-9-14-7-1-5-6(2-8(7)16-9)12-4-13-10(5)15/h1-2,4H,(H,12,13,15) |
| InChIKey | WTPDZEYDRNXCAA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-oxo-7H-[1,3]thiazolo[4,5-g]quinazoline-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxo-7H-[1,3]thiazolo[4,5-g]quinazoline-2-carbonitrile?
The IUPAC name of 8-oxo-7H-[1,3]thiazolo[4,5-g]quinazoline-2-carbonitrile (CID 136726272) is 8-oxo-7H-[1,3]thiazolo[4,5-g]quinazoline-2-carbonitrile.
What is the SMILES notation for 8-oxo-7H-[1,3]thiazolo[4,5-g]quinazoline-2-carbonitrile?
The canonical SMILES for 8-oxo-7H-[1,3]thiazolo[4,5-g]quinazoline-2-carbonitrile is N#Cc1nc2cc3c(=O)[nH]cnc3cc2s1.
What is the InChIKey of 8-oxo-7H-[1,3]thiazolo[4,5-g]quinazoline-2-carbonitrile?
The InChIKey is WTPDZEYDRNXCAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4N4OS/c11-3-9-14-7-1-5-6(2-8(7)16-9)12-4-13-10(5)15/h1-2,4H,(H,12,13,15).
What are the key properties of 8-oxo-7H-[1,3]thiazolo[4,5-g]quinazoline-2-carbonitrile?
8-oxo-7H-[1,3]thiazolo[4,5-g]quinazoline-2-carbonitrile has a molecular weight of 228.24 g/mol, XLogP of 1.40, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxo-7H-[1,3]thiazolo[4,5-g]quinazoline-2-carbonitrile is sourced from PubChem (CID 136726272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).