C12H20N6O — CID 136726374
3-(2,4-dimethyl-1,4-diazepan-1-yl)-N'-hydroxypyridazine-4-carboximidamide (PubChem CID 136726374) has the molecular formula C12H20N6O and a molecular weight of 264.33 g/mol. Its IUPAC name is 3-(2,4-dimethyl-1,4-diazepan-1-yl)-N'-hydroxypyridazine-4-carboximidamide.
| Compound Name | 3-(2,4-dimethyl-1,4-diazepan-1-yl)-N'-hydroxypyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 136726374 |
| Molecular Formula | C12H20N6O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 3-(2,4-dimethyl-1,4-diazepan-1-yl)-N'-hydroxypyridazine-4-carboximidamide |
| SMILES | CC1CN(C)CCCN1c1nnccc1/C(N)=N/O |
| InChI | InChI=1S/C12H20N6O/c1-9-8-17(2)6-3-7-18(9)12-10(11(13)16-19)4-5-14-15-12/h4-5,9,19H,3,6-8H2,1-2H3,(H2,13,16) |
| InChIKey | CGKQDWRCPUMXFI-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|