C19H16N4O6 — CID 136726703
diethyl 14-hydroxy-12-oxo-2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3,5,7,9,13,15-heptaene-13,15-dicarboxylate (PubChem CID 136726703) has the molecular formula C19H16N4O6 and a molecular weight of 396.36 g/mol. Its IUPAC name is diethyl 14-hydroxy-12-oxo-2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3,5,7,9,13,15-heptaene-13,15-dicarboxylate.
| Compound Name | diethyl 14-hydroxy-12-oxo-2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3,5,7,9,13,15-heptaene-13,15-dicarboxylate |
|---|---|
| PubChem CID | 136726703 |
| Molecular Formula | C19H16N4O6 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | diethyl 14-hydroxy-12-oxo-2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3,5,7,9,13,15-heptaene-13,15-dicarboxylate |
| SMILES | CCOC(=O)c1c(O)c(C(=O)OCC)c2nc3[nH]c4ccccc4nc3n2c1=O |
| InChI | InChI=1S/C19H16N4O6/c1-3-28-18(26)11-13(24)12(19(27)29-4-2)17(25)23-15(11)22-14-16(23)21-10-8-6-5-7-9(10)20-14/h5-8,24H,3-4H2,1-2H3,(H,20,22) |
| InChIKey | SCBIVAQATPSEBE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |