C17H3N15O24 — CID 136726865
3,5-dinitro-2-N,6-N-bis(2,3,4,5,6-pentanitrophenyl)pyridine-2,6-diamine (PubChem CID 136726865) has the molecular formula C17H3N15O24 and a molecular weight of 801.29 g/mol. Its IUPAC name is 3,5-dinitro-2-N,6-N-bis(2,3,4,5,6-pentanitrophenyl)pyridine-2,6-diamine.
| Compound Name | 3,5-dinitro-2-N,6-N-bis(2,3,4,5,6-pentanitrophenyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 136726865 |
| Molecular Formula | C17H3N15O24 |
| Molecular Weight | 801.29 g/mol |
| Exact Mass | 800.95 |
| IUPAC Name | 3,5-dinitro-2-N,6-N-bis(2,3,4,5,6-pentanitrophenyl)pyridine-2,6-diamine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c2[N+](=O)[O-])nc1Nc1c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H3N15O24/c33-21(34)2-1-3(22(35)36)17(19-5-8(25(41)42)12(29(49)50)15(32(55)56)13(30(51)52)9(5)26(43)44)20-16(2)18-4-6(23(37)38)10(27(45)46)14(31(53)54)11(28(47)48)7(4)24(39)40/h1H,(H2,18,19,20) |
| InChIKey | ROAXVEDUEYKQEB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 554.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 27 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 27 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|