C11H13FN4O — CID 136728217
4-ethylimino-6-(4-fluorophenyl)-1,3,5-triazinan-2-one (PubChem CID 136728217) has the molecular formula C11H13FN4O and a molecular weight of 236.25 g/mol. Its IUPAC name is 4-ethylimino-6-(4-fluorophenyl)-1,3,5-triazinan-2-one.
| Compound Name | 4-ethylimino-6-(4-fluorophenyl)-1,3,5-triazinan-2-one |
|---|---|
| PubChem CID | 136728217 |
| Molecular Formula | C11H13FN4O |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 4-ethylimino-6-(4-fluorophenyl)-1,3,5-triazinan-2-one |
| SMILES | CC/N=C1\NC(=O)NC(c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C11H13FN4O/c1-2-13-10-14-9(15-11(17)16-10)7-3-5-8(12)6-4-7/h3-6,9H,2H2,1H3,(H3,13,14,15,16,17) |
| InChIKey | XWRLROSVVBGPPA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|