About 4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one
4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one (PubChem CID 136728226) has the molecular formula C8H11ClF2N4O
and a molecular weight of 252.65 g/mol. Its IUPAC name is 4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one |
| PubChem CID | 136728226 |
| Molecular Formula | C8H11ClF2N4O |
| Molecular Weight | 252.65 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one |
| SMILES | NCCN(CC(F)F)c1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C8H11ClF2N4O/c9-6-7(13-4-14-8(6)16)15(2-1-12)3-5(10)11/h4-5H,1-3,12H2,(H,13,14,16) |
| InChIKey | ZVQQPLIQODAQIW-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.65 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one?
The IUPAC name of 4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one (CID 136728226) is 4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one?
The canonical SMILES for 4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one is NCCN(CC(F)F)c1nc[nH]c(=O)c1Cl.
What is the InChIKey of 4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one?
The InChIKey is ZVQQPLIQODAQIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClF2N4O/c9-6-7(13-4-14-8(6)16)15(2-1-12)3-5(10)11/h4-5H,1-3,12H2,(H,13,14,16).
What are the key properties of 4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one?
4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one has a molecular weight of 252.65 g/mol, XLogP of 0.45, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-aminoethyl(2,2-difluoroethyl)amino]-5-chloro-1H-pyrimidin-6-one is sourced from PubChem (CID 136728226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).