C18H17N5O5 — CID 136728747
(9S)-6,6-dimethyl-9-(6-nitro-1,3-benzodioxol-5-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136728747) has the molecular formula C18H17N5O5 and a molecular weight of 383.36 g/mol. Its IUPAC name is (9S)-6,6-dimethyl-9-(6-nitro-1,3-benzodioxol-5-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9S)-6,6-dimethyl-9-(6-nitro-1,3-benzodioxol-5-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136728747 |
| Molecular Formula | C18H17N5O5 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | (9S)-6,6-dimethyl-9-(6-nitro-1,3-benzodioxol-5-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ncnn1[C@H]2c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C18H17N5O5/c1-18(2)5-10-15(12(24)6-18)16(22-17(21-10)19-7-20-22)9-3-13-14(28-8-27-13)4-11(9)23(25)26/h3-4,7,16H,5-6,8H2,1-2H3,(H,19,20,21)/t16-/m0/s1 |
| InChIKey | UEWPUWJQYSWZEL-INIZCTEOSA-N |
| XLogP | 2.57 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|