C18H22N4O2S — CID 136728794
3-[(2S)-3-oxo-5-sulfanylidene-1,2-dihydroimidazo[1,2-c]quinazolin-2-yl]-N-pentylpropanamide (PubChem CID 136728794) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 3-[(2S)-3-oxo-5-sulfanylidene-1,2-dihydroimidazo[1,2-c]quinazolin-2-yl]-N-pentylpropanamide.
| Compound Name | 3-[(2S)-3-oxo-5-sulfanylidene-1,2-dihydroimidazo[1,2-c]quinazolin-2-yl]-N-pentylpropanamide |
|---|---|
| PubChem CID | 136728794 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 3-[(2S)-3-oxo-5-sulfanylidene-1,2-dihydroimidazo[1,2-c]quinazolin-2-yl]-N-pentylpropanamide |
| SMILES | CCCCCNC(=O)CC[C@@H]1Nc2c3ccccc3nc(=S)n2C1=O |
| InChI | InChI=1S/C18H22N4O2S/c1-2-3-6-11-19-15(23)10-9-14-17(24)22-16(20-14)12-7-4-5-8-13(12)21-18(22)25/h4-5,7-8,14,20H,2-3,6,9-11H2,1H3,(H,19,23)/t14-/m0/s1 |
| InChIKey | HEXXJIXKNUASNV-AWEZNQCLSA-N |
| XLogP | 3.29 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|