C43H45NO4 — CID 136729199
11-[[(1R)-1-phenylethyl]iminomethyl]-26,28-di(propan-2-yloxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-25,27-diol (PubChem CID 136729199) has the molecular formula C43H45NO4 and a molecular weight of 639.84 g/mol. Its IUPAC name is 11-[[(1R)-1-phenylethyl]iminomethyl]-26,28-di(propan-2-yloxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-25,27-diol.
| Compound Name | 11-[[(1R)-1-phenylethyl]iminomethyl]-26,28-di(propan-2-yloxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-25,27-diol |
|---|---|
| PubChem CID | 136729199 |
| Molecular Formula | C43H45NO4 |
| Molecular Weight | 639.84 g/mol |
| Exact Mass | 639.33 |
| IUPAC Name | 11-[[(1R)-1-phenylethyl]iminomethyl]-26,28-di(propan-2-yloxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-25,27-diol |
| SMILES | CC(C)Oc1c2cccc1Cc1cc(/C=N/[C@H](C)c3ccccc3)cc(c1O)Cc1cccc(c1OC(C)C)Cc1cccc(c1O)C2 |
| InChI | InChI=1S/C43H45NO4/c1-27(2)47-42-34-16-10-18-36(42)24-38-20-30(26-44-29(5)31-12-7-6-8-13-31)21-39(41(38)46)25-37-19-11-17-35(43(37)48-28(3)4)23-33-15-9-14-32(22-34)40(33)45/h6-21,26-29,45-46H,22-25H2,1-5H3/b44-26+/t29-/m1/s1 |
| InChIKey | UCQUVRDCTJKDMD-IESSQIBESA-N |
| XLogP | 9.53 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.84 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|