About 4-cyclopentyl-2-[(2,4-difluorophenyl)methyl]-1H-pyrimidin-6-one
4-cyclopentyl-2-[(2,4-difluorophenyl)methyl]-1H-pyrimidin-6-one (PubChem CID 136729559) has the molecular formula C16H16F2N2O
and a molecular weight of 290.31 g/mol. Its IUPAC name is 4-cyclopentyl-2-[(2,4-difluorophenyl)methyl]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-cyclopentyl-2-[(2,4-difluorophenyl)methyl]-1H-pyrimidin-6-one |
| PubChem CID | 136729559 |
| Molecular Formula | C16H16F2N2O |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-cyclopentyl-2-[(2,4-difluorophenyl)methyl]-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C2CCCC2)nc(Cc2ccc(F)cc2F)[nH]1 |
| InChI | InChI=1S/C16H16F2N2O/c17-12-6-5-11(13(18)8-12)7-15-19-14(9-16(21)20-15)10-3-1-2-4-10/h5-6,8-10H,1-4,7H2,(H,19,20,21) |
| InChIKey | MGDYXCBPGMHIML-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclopentyl-2-[(2,4-difluorophenyl)methyl]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopentyl-2-[(2,4-difluorophenyl)methyl]-1H-pyrimidin-6-one?
The IUPAC name of 4-cyclopentyl-2-[(2,4-difluorophenyl)methyl]-1H-pyrimidin-6-one (CID 136729559) is 4-cyclopentyl-2-[(2,4-difluorophenyl)methyl]-1H-pyrimidin-6-one.
What is the SMILES notation for 4-cyclopentyl-2-[(2,4-difluorophenyl)methyl]-1H-pyrimidin-6-one?
The canonical SMILES for 4-cyclopentyl-2-[(2,4-difluorophenyl)methyl]-1H-pyrimidin-6-one is O=c1cc(C2CCCC2)nc(Cc2ccc(F)cc2F)[nH]1.
What is the InChIKey of 4-cyclopentyl-2-[(2,4-difluorophenyl)methyl]-1H-pyrimidin-6-one?
The InChIKey is MGDYXCBPGMHIML-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F2N2O/c17-12-6-5-11(13(18)8-12)7-15-19-14(9-16(21)20-15)10-3-1-2-4-10/h5-6,8-10H,1-4,7H2,(H,19,20,21).
What are the key properties of 4-cyclopentyl-2-[(2,4-difluorophenyl)methyl]-1H-pyrimidin-6-one?
4-cyclopentyl-2-[(2,4-difluorophenyl)methyl]-1H-pyrimidin-6-one has a molecular weight of 290.31 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentyl-2-[(2,4-difluorophenyl)methyl]-1H-pyrimidin-6-one is sourced from PubChem (CID 136729559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).