C15H13BrCl2N2O — CID 136729711
5-bromo-4-cyclopentyl-2-(3,4-dichlorophenyl)-1H-pyrimidin-6-one (PubChem CID 136729711) has the molecular formula C15H13BrCl2N2O and a molecular weight of 388.09 g/mol. Its IUPAC name is 5-bromo-4-cyclopentyl-2-(3,4-dichlorophenyl)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-cyclopentyl-2-(3,4-dichlorophenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136729711 |
| Molecular Formula | C15H13BrCl2N2O |
| Molecular Weight | 388.09 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | 5-bromo-4-cyclopentyl-2-(3,4-dichlorophenyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(-c2ccc(Cl)c(Cl)c2)nc(C2CCCC2)c1Br |
| InChI | InChI=1S/C15H13BrCl2N2O/c16-12-13(8-3-1-2-4-8)19-14(20-15(12)21)9-5-6-10(17)11(18)7-9/h5-8H,1-4H2,(H,19,20,21) |
| InChIKey | BNTGJXATQOXWLQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.09 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |