C11H12F3IN2O — CID 136729816
4-cyclopentyl-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one (PubChem CID 136729816) has the molecular formula C11H12F3IN2O and a molecular weight of 372.13 g/mol. Its IUPAC name is 4-cyclopentyl-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-cyclopentyl-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136729816 |
| Molecular Formula | C11H12F3IN2O |
| Molecular Weight | 372.13 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 4-cyclopentyl-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(CC(F)(F)F)nc(C2CCCC2)c1I |
| InChI | InChI=1S/C11H12F3IN2O/c12-11(13,14)5-7-16-9(6-3-1-2-4-6)8(15)10(18)17-7/h6H,1-5H2,(H,16,17,18) |
| InChIKey | VFFZSBZDAATEEV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.13 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|