C16H17IN2O — CID 136729850
4-cyclopentyl-5-iodo-2-(2-methylphenyl)-1H-pyrimidin-6-one (PubChem CID 136729850) has the molecular formula C16H17IN2O and a molecular weight of 380.23 g/mol. Its IUPAC name is 4-cyclopentyl-5-iodo-2-(2-methylphenyl)-1H-pyrimidin-6-one.
| Compound Name | 4-cyclopentyl-5-iodo-2-(2-methylphenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136729850 |
| Molecular Formula | C16H17IN2O |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 4-cyclopentyl-5-iodo-2-(2-methylphenyl)-1H-pyrimidin-6-one |
| SMILES | Cc1ccccc1-c1nc(C2CCCC2)c(I)c(=O)[nH]1 |
| InChI | InChI=1S/C16H17IN2O/c1-10-6-2-5-9-12(10)15-18-14(11-7-3-4-8-11)13(17)16(20)19-15/h2,5-6,9,11H,3-4,7-8H2,1H3,(H,18,19,20) |
| InChIKey | SQPZGOMPQDUJOX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|