C9H17N5O2 — CID 136730542
5-amino-4-[3-(2-aminoethoxy)propylamino]-1H-pyrimidin-6-one (PubChem CID 136730542) has the molecular formula C9H17N5O2 and a molecular weight of 227.27 g/mol. Its IUPAC name is 5-amino-4-[3-(2-aminoethoxy)propylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-[3-(2-aminoethoxy)propylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136730542 |
| Molecular Formula | C9H17N5O2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 5-amino-4-[3-(2-aminoethoxy)propylamino]-1H-pyrimidin-6-one |
| SMILES | NCCOCCCNc1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C9H17N5O2/c10-2-5-16-4-1-3-12-8-7(11)9(15)14-6-13-8/h6H,1-5,10-11H2,(H2,12,13,14,15) |
| InChIKey | OLZKDXJSUKLVBV-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|