C11H16IN3OS — CID 136730580
5-iodo-4-[(3-methylsulfanylcyclohexyl)amino]-1H-pyrimidin-6-one (PubChem CID 136730580) has the molecular formula C11H16IN3OS and a molecular weight of 365.24 g/mol. Its IUPAC name is 5-iodo-4-[(3-methylsulfanylcyclohexyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-[(3-methylsulfanylcyclohexyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136730580 |
| Molecular Formula | C11H16IN3OS |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 5-iodo-4-[(3-methylsulfanylcyclohexyl)amino]-1H-pyrimidin-6-one |
| SMILES | CSC1CCCC(Nc2nc[nH]c(=O)c2I)C1 |
| InChI | InChI=1S/C11H16IN3OS/c1-17-8-4-2-3-7(5-8)15-10-9(12)11(16)14-6-13-10/h6-8H,2-5H2,1H3,(H2,13,14,15,16) |
| InChIKey | XWODRQOTYGDYOE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|