C23H27N5O — CID 136730678
[(2R)-3-cyclopentyliminospiro[1,4-dihydropyrido[2,3-b]pyrazine-2,3'-piperidine]-1'-yl]-phenylmethanone (PubChem CID 136730678) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is [(2R)-3-cyclopentyliminospiro[1,4-dihydropyrido[2,3-b]pyrazine-2,3'-piperidine]-1'-yl]-phenylmethanone.
| Compound Name | [(2R)-3-cyclopentyliminospiro[1,4-dihydropyrido[2,3-b]pyrazine-2,3'-piperidine]-1'-yl]-phenylmethanone |
|---|---|
| PubChem CID | 136730678 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | [(2R)-3-cyclopentyliminospiro[1,4-dihydropyrido[2,3-b]pyrazine-2,3'-piperidine]-1'-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCC[C@]2(C1)Nc1cccnc1N/C2=N\C1CCCC1 |
| InChI | InChI=1S/C23H27N5O/c29-21(17-8-2-1-3-9-17)28-15-7-13-23(16-28)22(25-18-10-4-5-11-18)26-20-19(27-23)12-6-14-24-20/h1-3,6,8-9,12,14,18,27H,4-5,7,10-11,13,15-16H2,(H,24,25,26)/t23-/m1/s1 |
| InChIKey | OQNWNKONXIJLOY-HSZRJFAPSA-N |
| XLogP | 3.94 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|