C25H30N6O — CID 136730753
(2S)-3-cyclopentylimino-N-(2,3-dihydro-1H-inden-5-yl)spiro[1,4-dihydropyrido[2,3-b]pyrazine-2,3'-pyrrolidine]-1'-carboxamide (PubChem CID 136730753) has the molecular formula C25H30N6O and a molecular weight of 430.56 g/mol. Its IUPAC name is (2S)-3-cyclopentylimino-N-(2,3-dihydro-1H-inden-5-yl)spiro[1,4-dihydropyrido[2,3-b]pyrazine-2,3'-pyrrolidine]-1'-carboxamide.
| Compound Name | (2S)-3-cyclopentylimino-N-(2,3-dihydro-1H-inden-5-yl)spiro[1,4-dihydropyrido[2,3-b]pyrazine-2,3'-pyrrolidine]-1'-carboxamide |
|---|---|
| PubChem CID | 136730753 |
| Molecular Formula | C25H30N6O |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (2S)-3-cyclopentylimino-N-(2,3-dihydro-1H-inden-5-yl)spiro[1,4-dihydropyrido[2,3-b]pyrazine-2,3'-pyrrolidine]-1'-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCC2)N1CC[C@@]2(C1)Nc1cccnc1N/C2=N\C1CCCC1 |
| InChI | InChI=1S/C25H30N6O/c32-24(28-20-11-10-17-5-3-6-18(17)15-20)31-14-12-25(16-31)23(27-19-7-1-2-8-19)29-22-21(30-25)9-4-13-26-22/h4,9-11,13,15,19,30H,1-3,5-8,12,14,16H2,(H,28,32)(H,26,27,29)/t25-/m0/s1 |
| InChIKey | TURRDHKZTDKVEG-VWLOTQADSA-N |
| XLogP | 4.43 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|