C10H8ClFN4OS — CID 136731401
4-amino-2-(2-amino-5-chloro-4-fluorophenyl)sulfanyl-1H-pyrimidin-6-one (PubChem CID 136731401) has the molecular formula C10H8ClFN4OS and a molecular weight of 286.72 g/mol. Its IUPAC name is 4-amino-2-(2-amino-5-chloro-4-fluorophenyl)sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-(2-amino-5-chloro-4-fluorophenyl)sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136731401 |
| Molecular Formula | C10H8ClFN4OS |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 4-amino-2-(2-amino-5-chloro-4-fluorophenyl)sulfanyl-1H-pyrimidin-6-one |
| SMILES | Nc1cc(=O)[nH]c(Sc2cc(Cl)c(F)cc2N)n1 |
| InChI | InChI=1S/C10H8ClFN4OS/c11-4-1-7(6(13)2-5(4)12)18-10-15-8(14)3-9(17)16-10/h1-3H,13H2,(H3,14,15,16,17) |
| InChIKey | TWUAPUCBMICULP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|