C9H14N4O2 — CID 136731515
2-[(1-methylpyrrolidin-2-yl)methylimino]imidazolidine-4,5-dione (PubChem CID 136731515) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 2-[(1-methylpyrrolidin-2-yl)methylimino]imidazolidine-4,5-dione.
| Compound Name | 2-[(1-methylpyrrolidin-2-yl)methylimino]imidazolidine-4,5-dione |
|---|---|
| PubChem CID | 136731515 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 2-[(1-methylpyrrolidin-2-yl)methylimino]imidazolidine-4,5-dione |
| SMILES | CN1CCCC1CN=C1NC(=O)C(=O)N1 |
| InChI | InChI=1S/C9H14N4O2/c1-13-4-2-3-6(13)5-10-9-11-7(14)8(15)12-9/h6H,2-5H2,1H3,(H2,10,11,12,14,15) |
| InChIKey | JCYYYXJZCVSTMW-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|