C17H18N4 — CID 136731597
9-butyl-4-methyl-2,3,8,10-tetrazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7(11),9,12,14-heptaene (PubChem CID 136731597) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is 9-butyl-4-methyl-2,3,8,10-tetrazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7(11),9,12,14-heptaene.
| Compound Name | 9-butyl-4-methyl-2,3,8,10-tetrazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7(11),9,12,14-heptaene |
|---|---|
| PubChem CID | 136731597 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 9-butyl-4-methyl-2,3,8,10-tetrazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7(11),9,12,14-heptaene |
| SMILES | CCCCc1nc2c3ccccc3n3nc(C)cc3c2[nH]1 |
| InChI | InChI=1S/C17H18N4/c1-3-4-9-15-18-16-12-7-5-6-8-13(12)21-14(17(16)19-15)10-11(2)20-21/h5-8,10H,3-4,9H2,1-2H3,(H,18,19) |
| InChIKey | OATFTEFLMDHDOD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |