C35H32N2O3 — CID 136731917
3-[[(1R,2R)-2-[(2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-1-(2-methoxynaphthalen-1-yl)naphthalen-2-ol (PubChem CID 136731917) has the molecular formula C35H32N2O3 and a molecular weight of 528.65 g/mol. Its IUPAC name is 3-[[(1R,2R)-2-[(2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-1-(2-methoxynaphthalen-1-yl)naphthalen-2-ol.
| Compound Name | 3-[[(1R,2R)-2-[(2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-1-(2-methoxynaphthalen-1-yl)naphthalen-2-ol |
|---|---|
| PubChem CID | 136731917 |
| Molecular Formula | C35H32N2O3 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 3-[[(1R,2R)-2-[(2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-1-(2-methoxynaphthalen-1-yl)naphthalen-2-ol |
| SMILES | COc1ccc2ccccc2c1-c1c(O)c(/C=N/[C@@H]2CCCC[C@H]2/N=C/c2ccccc2O)cc2ccccc12 |
| InChI | InChI=1S/C35H32N2O3/c1-40-32-19-18-23-10-2-5-13-27(23)33(32)34-28-14-6-3-11-24(28)20-26(35(34)39)22-37-30-16-8-7-15-29(30)36-21-25-12-4-9-17-31(25)38/h2-6,9-14,17-22,29-30,38-39H,7-8,15-16H2,1H3/b36-21+,37-22+/t29-,30-/m1/s1 |
| InChIKey | MTHPVACBTGFGOS-KAYIIQPESA-N |
| XLogP | 7.93 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|