C22H18Cl2N2O8S2 — CID 136731936
3-chloro-5-[[2-[(3-chloro-2-hydroxy-5-sulfophenyl)methylideneamino]-4,5-dimethylphenyl]iminomethyl]-4-hydroxybenzenesulfonic acid (PubChem CID 136731936) has the molecular formula C22H18Cl2N2O8S2 and a molecular weight of 573.43 g/mol. Its IUPAC name is 3-chloro-5-[[2-[(3-chloro-2-hydroxy-5-sulfophenyl)methylideneamino]-4,5-dimethylphenyl]iminomethyl]-4-hydroxybenzenesulfonic acid.
| Compound Name | 3-chloro-5-[[2-[(3-chloro-2-hydroxy-5-sulfophenyl)methylideneamino]-4,5-dimethylphenyl]iminomethyl]-4-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 136731936 |
| Molecular Formula | C22H18Cl2N2O8S2 |
| Molecular Weight | 573.43 g/mol |
| Exact Mass | 571.99 |
| IUPAC Name | 3-chloro-5-[[2-[(3-chloro-2-hydroxy-5-sulfophenyl)methylideneamino]-4,5-dimethylphenyl]iminomethyl]-4-hydroxybenzenesulfonic acid |
| SMILES | Cc1cc(/N=C/c2cc(S(=O)(=O)O)cc(Cl)c2O)c(/N=C/c2cc(S(=O)(=O)O)cc(Cl)c2O)cc1C |
| InChI | InChI=1S/C22H18Cl2N2O8S2/c1-11-3-19(25-9-13-5-15(35(29,30)31)7-17(23)21(13)27)20(4-12(11)2)26-10-14-6-16(36(32,33)34)8-18(24)22(14)28/h3-10,27-28H,1-2H3,(H,29,30,31)(H,32,33,34)/b25-9+,26-10+ |
| InChIKey | YHTYOLXDPXNZHC-ZZULHHKVSA-N |
| XLogP | 5.02 |
| TPSA | 173.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|