About 5-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)-1H-pyrimidin-6-one
5-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)-1H-pyrimidin-6-one (PubChem CID 136733803) has the molecular formula C9H12BrN3O3S
and a molecular weight of 322.18 g/mol. Its IUPAC name is 5-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)-1H-pyrimidin-6-one |
| PubChem CID | 136733803 |
| Molecular Formula | C9H12BrN3O3S |
| Molecular Weight | 322.18 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | 5-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N2CCCS(=O)(=O)CC2)c1Br |
| InChI | InChI=1S/C9H12BrN3O3S/c10-7-8(11-6-12-9(7)14)13-2-1-4-17(15,16)5-3-13/h6H,1-5H2,(H,11,12,14) |
| InChIKey | OFNNMZSFQYISBK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.18 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)-1H-pyrimidin-6-one?
The IUPAC name of 5-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)-1H-pyrimidin-6-one (CID 136733803) is 5-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)-1H-pyrimidin-6-one?
The canonical SMILES for 5-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)-1H-pyrimidin-6-one is O=c1[nH]cnc(N2CCCS(=O)(=O)CC2)c1Br.
What is the InChIKey of 5-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)-1H-pyrimidin-6-one?
The InChIKey is OFNNMZSFQYISBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrN3O3S/c10-7-8(11-6-12-9(7)14)13-2-1-4-17(15,16)5-3-13/h6H,1-5H2,(H,11,12,14).
What are the key properties of 5-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)-1H-pyrimidin-6-one?
5-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)-1H-pyrimidin-6-one has a molecular weight of 322.18 g/mol, XLogP of 0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-(1,1-dioxo-1,4-thiazepan-4-yl)-1H-pyrimidin-6-one is sourced from PubChem (CID 136733803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).