C12H20N4O3 — CID 136734037
2-[2-(dimethylamino)ethyl-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)amino]acetic acid (PubChem CID 136734037) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)amino]acetic acid.
| Compound Name | 2-[2-(dimethylamino)ethyl-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)amino]acetic acid |
|---|---|
| PubChem CID | 136734037 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)amino]acetic acid |
| SMILES | CCc1nc(N(CCN(C)C)CC(=O)O)cc(=O)[nH]1 |
| InChI | InChI=1S/C12H20N4O3/c1-4-9-13-10(7-11(17)14-9)16(8-12(18)19)6-5-15(2)3/h7H,4-6,8H2,1-3H3,(H,18,19)(H,13,14,17) |
| InChIKey | PDGAOSMQICIGRA-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |