C40H30N4S4 — CID 136734792
5,10,15,20-tetrakis(3-methylthiophen-2-yl)-21,23-dihydroporphyrin (PubChem CID 136734792) has the molecular formula C40H30N4S4 and a molecular weight of 694.98 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(3-methylthiophen-2-yl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(3-methylthiophen-2-yl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136734792 |
| Molecular Formula | C40H30N4S4 |
| Molecular Weight | 694.98 g/mol |
| Exact Mass | 694.14 |
| IUPAC Name | 5,10,15,20-tetrakis(3-methylthiophen-2-yl)-21,23-dihydroporphyrin |
| SMILES | Cc1ccsc1-c1c2nc(c(-c3sccc3C)c3ccc([nH]3)c(-c3sccc3C)c3nc(c(-c4sccc4C)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C40H30N4S4/c1-21-13-17-45-37(21)33-25-5-7-27(41-25)34(38-22(2)14-18-46-38)29-9-11-31(43-29)36(40-24(4)16-20-48-40)32-12-10-30(44-32)35(28-8-6-26(33)42-28)39-23(3)15-19-47-39/h5-20,41,44H,1-4H3/b33-25+,33-26+,34-27+,34-29+,35-28+,35-30+,36-31+,36-32+ |
| InChIKey | IUXGEFLHOGSTTP-KRQUYQEWSA-N |
| XLogP | 12.80 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.98 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |