C18H22N4O2 — CID 136734998
4-ethyl-2-[(3R)-1-(6-methylpyridine-3-carbonyl)piperidin-3-yl]-1H-pyrimidin-6-one (PubChem CID 136734998) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 4-ethyl-2-[(3R)-1-(6-methylpyridine-3-carbonyl)piperidin-3-yl]-1H-pyrimidin-6-one.
| Compound Name | 4-ethyl-2-[(3R)-1-(6-methylpyridine-3-carbonyl)piperidin-3-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136734998 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 4-ethyl-2-[(3R)-1-(6-methylpyridine-3-carbonyl)piperidin-3-yl]-1H-pyrimidin-6-one |
| SMILES | CCc1cc(=O)[nH]c([C@@H]2CCCN(C(=O)c3ccc(C)nc3)C2)n1 |
| InChI | InChI=1S/C18H22N4O2/c1-3-15-9-16(23)21-17(20-15)14-5-4-8-22(11-14)18(24)13-7-6-12(2)19-10-13/h6-7,9-10,14H,3-5,8,11H2,1-2H3,(H,20,21,23)/t14-/m1/s1 |
| InChIKey | GDVSGKIWTGXDQK-CQSZACIVSA-N |
| XLogP | 2.06 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |