C15H11ClN4S — CID 136735908
7-chloro-5-phenyl-4,5-dihydro-2H-[1,2,4]triazolo[4,3-a]quinazoline-1-thione (PubChem CID 136735908) has the molecular formula C15H11ClN4S and a molecular weight of 314.80 g/mol. Its IUPAC name is 7-chloro-5-phenyl-4,5-dihydro-2H-[1,2,4]triazolo[4,3-a]quinazoline-1-thione.
| Compound Name | 7-chloro-5-phenyl-4,5-dihydro-2H-[1,2,4]triazolo[4,3-a]quinazoline-1-thione |
|---|---|
| PubChem CID | 136735908 |
| Molecular Formula | C15H11ClN4S |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 7-chloro-5-phenyl-4,5-dihydro-2H-[1,2,4]triazolo[4,3-a]quinazoline-1-thione |
| SMILES | S=c1[nH]nc2n1-c1ccc(Cl)cc1C(c1ccccc1)N2 |
| InChI | InChI=1S/C15H11ClN4S/c16-10-6-7-12-11(8-10)13(9-4-2-1-3-5-9)17-14-18-19-15(21)20(12)14/h1-8,13H,(H,17,18)(H,19,21) |
| InChIKey | NWTJDMPBDDVTNP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|