C21H22N4O3 — CID 136736359
(7R)-5-(4-methylphenyl)-7-(2,3,4-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136736359) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is (7R)-5-(4-methylphenyl)-7-(2,3,4-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | (7R)-5-(4-methylphenyl)-7-(2,3,4-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136736359 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (7R)-5-(4-methylphenyl)-7-(2,3,4-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | COc1ccc([C@H]2C=C(c3ccc(C)cc3)Nc3ncnn32)c(OC)c1OC |
| InChI | InChI=1S/C21H22N4O3/c1-13-5-7-14(8-6-13)16-11-17(25-21(24-16)22-12-23-25)15-9-10-18(26-2)20(28-4)19(15)27-3/h5-12,17H,1-4H3,(H,22,23,24)/t17-/m1/s1 |
| InChIKey | HJTHEBCNJAWKLY-QGZVFWFLSA-N |
| XLogP | 3.67 |
| TPSA | 70.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |