C46H40N4O4 — CID 136738712
5,17-bis(phenyldiazenyl)-11,23-bis(prop-2-enyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol (PubChem CID 136738712) has the molecular formula C46H40N4O4 and a molecular weight of 712.85 g/mol. Its IUPAC name is 5,17-bis(phenyldiazenyl)-11,23-bis(prop-2-enyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol.
| Compound Name | 5,17-bis(phenyldiazenyl)-11,23-bis(prop-2-enyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol |
|---|---|
| PubChem CID | 136738712 |
| Molecular Formula | C46H40N4O4 |
| Molecular Weight | 712.85 g/mol |
| Exact Mass | 712.30 |
| IUPAC Name | 5,17-bis(phenyldiazenyl)-11,23-bis(prop-2-enyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol |
| SMILES | C=CCc1cc2c(O)c(c1)Cc1cc(/N=N/c3ccccc3)cc(c1O)Cc1cc(CC=C)cc(c1O)Cc1cc(/N=N/c3ccccc3)cc(c1O)C2 |
| InChI | InChI=1S/C46H40N4O4/c1-3-11-29-17-31-21-35-25-41(49-47-39-13-7-5-8-14-39)27-37(45(35)53)23-33-19-30(12-4-2)20-34(44(33)52)24-38-28-42(50-48-40-15-9-6-10-16-40)26-36(46(38)54)22-32(18-29)43(31)51/h3-10,13-20,25-28,51-54H,1-2,11-12,21-24H2/b49-47+,50-48+ |
| InChIKey | HIFIQUDMHLJLJR-RYZURTRPSA-N |
| XLogP | 11.47 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.85 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|