C38H23F4N5OS — CID 136738836
4-[15-[4-(2-aminophenyl)sulfanyl-2,3,5,6-tetrafluorophenyl]-21,23-dihydroporphyrin-5-yl]phenol (PubChem CID 136738836) has the molecular formula C38H23F4N5OS and a molecular weight of 673.70 g/mol. Its IUPAC name is 4-[15-[4-(2-aminophenyl)sulfanyl-2,3,5,6-tetrafluorophenyl]-21,23-dihydroporphyrin-5-yl]phenol.
| Compound Name | 4-[15-[4-(2-aminophenyl)sulfanyl-2,3,5,6-tetrafluorophenyl]-21,23-dihydroporphyrin-5-yl]phenol |
|---|---|
| PubChem CID | 136738836 |
| Molecular Formula | C38H23F4N5OS |
| Molecular Weight | 673.70 g/mol |
| Exact Mass | 673.16 |
| IUPAC Name | 4-[15-[4-(2-aminophenyl)sulfanyl-2,3,5,6-tetrafluorophenyl]-21,23-dihydroporphyrin-5-yl]phenol |
| SMILES | Nc1ccccc1Sc1c(F)c(F)c(-c2c3nc(cc4ccc([nH]4)c(-c4ccc(O)cc4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)c(F)c1F |
| InChI | InChI=1S/C38H23F4N5OS/c39-34-33(35(40)37(42)38(36(34)41)49-30-4-2-1-3-25(30)43)32-28-15-9-22(46-28)17-20-7-13-26(44-20)31(19-5-11-24(48)12-6-19)27-14-8-21(45-27)18-23-10-16-29(32)47-23/h1-18,44,47-48H,43H2/b20-17-,21-18-,22-17-,23-18-,31-26-,31-27-,32-28+,32-29+ |
| InChIKey | GTOXDDIWWLGLLM-QJOFSHLNSA-N |
| XLogP | 9.98 |
| TPSA | 103.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.70 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|