C39H24F4N4OS — CID 136738844
4-[15-(4-benzylsulfanyl-2,3,5,6-tetrafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenol (PubChem CID 136738844) has the molecular formula C39H24F4N4OS and a molecular weight of 672.71 g/mol. Its IUPAC name is 4-[15-(4-benzylsulfanyl-2,3,5,6-tetrafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenol.
| Compound Name | 4-[15-(4-benzylsulfanyl-2,3,5,6-tetrafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenol |
|---|---|
| PubChem CID | 136738844 |
| Molecular Formula | C39H24F4N4OS |
| Molecular Weight | 672.71 g/mol |
| Exact Mass | 672.16 |
| IUPAC Name | 4-[15-(4-benzylsulfanyl-2,3,5,6-tetrafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenol |
| SMILES | Oc1ccc(-c2c3nc(cc4ccc([nH]4)c(-c4c(F)c(F)c(SCc5ccccc5)c(F)c4F)c4nc(cc5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C39H24F4N4OS/c40-35-34(36(41)38(43)39(37(35)42)49-20-21-4-2-1-3-5-21)33-30-16-10-25(46-30)18-23-8-14-28(44-23)32(22-6-12-27(48)13-7-22)29-15-9-24(45-29)19-26-11-17-31(33)47-26/h1-19,44,47-48H,20H2/b23-18-,24-19-,25-18-,26-19-,32-28-,32-29-,33-30+,33-31+ |
| InChIKey | ABKIOWRDMOKCMM-YTGWQUQHSA-N |
| XLogP | 10.54 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.71 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|