C38H22F4N4OS — CID 136738852
4-[15-(2,3,5,6-tetrafluoro-4-phenylsulfanylphenyl)-21,23-dihydroporphyrin-5-yl]phenol (PubChem CID 136738852) has the molecular formula C38H22F4N4OS and a molecular weight of 658.68 g/mol. Its IUPAC name is 4-[15-(2,3,5,6-tetrafluoro-4-phenylsulfanylphenyl)-21,23-dihydroporphyrin-5-yl]phenol.
| Compound Name | 4-[15-(2,3,5,6-tetrafluoro-4-phenylsulfanylphenyl)-21,23-dihydroporphyrin-5-yl]phenol |
|---|---|
| PubChem CID | 136738852 |
| Molecular Formula | C38H22F4N4OS |
| Molecular Weight | 658.68 g/mol |
| Exact Mass | 658.15 |
| IUPAC Name | 4-[15-(2,3,5,6-tetrafluoro-4-phenylsulfanylphenyl)-21,23-dihydroporphyrin-5-yl]phenol |
| SMILES | Oc1ccc(-c2c3nc(cc4ccc([nH]4)c(-c4c(F)c(F)c(Sc5ccccc5)c(F)c4F)c4nc(cc5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C38H22F4N4OS/c39-34-33(35(40)37(42)38(36(34)41)48-26-4-2-1-3-5-26)32-29-16-10-23(45-29)18-21-8-14-27(43-21)31(20-6-12-25(47)13-7-20)28-15-9-22(44-28)19-24-11-17-30(32)46-24/h1-19,43,46-47H/b21-18-,22-19-,23-18-,24-19-,31-27-,31-28-,32-29+,32-30+ |
| InChIKey | KBZNKGIIUGOZTJ-KNZWHTTDSA-N |
| XLogP | 10.40 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.68 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|