C14H8N4O2 — CID 136739967
1,4-dihydropyrazino[2,3-f][1,10]phenanthroline-5,12-dione (PubChem CID 136739967) has the molecular formula C14H8N4O2 and a molecular weight of 264.24 g/mol. Its IUPAC name is 1,4-dihydropyrazino[2,3-f][1,10]phenanthroline-5,12-dione.
| Compound Name | 1,4-dihydropyrazino[2,3-f][1,10]phenanthroline-5,12-dione |
|---|---|
| PubChem CID | 136739967 |
| Molecular Formula | C14H8N4O2 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 1,4-dihydropyrazino[2,3-f][1,10]phenanthroline-5,12-dione |
| SMILES | O=c1ccnc2c3nccc(=O)c3c3[nH]cc[nH]c3c12 |
| InChI | InChI=1S/C14H8N4O2/c19-7-1-3-15-11-9(7)13-14(18-6-5-17-13)10-8(20)2-4-16-12(10)11/h1-6,17-18H |
| InChIKey | CSSQERASTFHLHB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|