C19H18N8O8 — CID 136740145
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]-3-nitrobenzoyl]amino]pentanedioic acid (PubChem CID 136740145) has the molecular formula C19H18N8O8 and a molecular weight of 486.40 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]-3-nitrobenzoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]-3-nitrobenzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 136740145 |
| Molecular Formula | C19H18N8O8 |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]-3-nitrobenzoyl]amino]pentanedioic acid |
| SMILES | Nc1nc2ncc(CNc3ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc3[N+](=O)[O-])nc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H18N8O8/c20-19-25-15-14(17(31)26-19)23-9(7-22-15)6-21-10-2-1-8(5-12(10)27(34)35)16(30)24-11(18(32)33)3-4-13(28)29/h1-2,5,7,11,21H,3-4,6H2,(H,24,30)(H,28,29)(H,32,33)(H3,20,22,25,26,31)/t11-/m0/s1 |
| InChIKey | OPGWPDSACKHWPE-NSHDSACASA-N |
| XLogP | -0.14 |
| TPSA | 256.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|