C14H19N7O — CID 136740178
3-[(1R)-1-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]ethyl]-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 136740178) has the molecular formula C14H19N7O and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-[(1R)-1-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]ethyl]-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-[(1R)-1-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]ethyl]-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 136740178 |
| Molecular Formula | C14H19N7O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 3-[(1R)-1-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]ethyl]-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | CCc1cc(N[C@H](C)c2n[nH]c(=O)[nH]2)n2nc(C)c(C)c2n1 |
| InChI | InChI=1S/C14H19N7O/c1-5-10-6-11(15-9(4)12-17-14(22)19-18-12)21-13(16-10)7(2)8(3)20-21/h6,9,15H,5H2,1-4H3,(H2,17,18,19,22)/t9-/m1/s1 |
| InChIKey | VIVWPFSYWCGFST-SECBINFHSA-N |
| XLogP | 1.49 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |