C21H21N5O4 — CID 136740591
2-[2-methoxy-4-[(E)-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]-N-phenylacetamide (PubChem CID 136740591) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(E)-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-methoxy-4-[(E)-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 136740591 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 2-[2-methoxy-4-[(E)-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]-N-phenylacetamide |
| SMILES | COc1cc(/C=N/Nc2nc(C)cc(=O)[nH]2)ccc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H21N5O4/c1-14-10-19(27)25-21(23-14)26-22-12-15-8-9-17(18(11-15)29-2)30-13-20(28)24-16-6-4-3-5-7-16/h3-12H,13H2,1-2H3,(H,24,28)(H2,23,25,26,27)/b22-12+ |
| InChIKey | JMKGWWQPKCEFPW-WSDLNYQXSA-N |
| XLogP | 2.55 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|