C11H18N4O — CID 136740718
2-methyl-4-[(piperidin-3-ylamino)methyl]-1H-pyrimidin-6-one (PubChem CID 136740718) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-methyl-4-[(piperidin-3-ylamino)methyl]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-[(piperidin-3-ylamino)methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136740718 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 2-methyl-4-[(piperidin-3-ylamino)methyl]-1H-pyrimidin-6-one |
| SMILES | Cc1nc(CNC2CCCNC2)cc(=O)[nH]1 |
| InChI | InChI=1S/C11H18N4O/c1-8-14-10(5-11(16)15-8)7-13-9-3-2-4-12-6-9/h5,9,12-13H,2-4,6-7H2,1H3,(H,14,15,16) |
| InChIKey | QWTIJDWIZVUDSK-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |