C9H12F3N3O — CID 136741329
2-[[(2S)-butan-2-yl]amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 136741329) has the molecular formula C9H12F3N3O and a molecular weight of 235.21 g/mol. Its IUPAC name is 2-[[(2S)-butan-2-yl]amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[[(2S)-butan-2-yl]amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136741329 |
| Molecular Formula | C9H12F3N3O |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 2-[[(2S)-butan-2-yl]amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | CC[C@H](C)Nc1nc(C(F)(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C9H12F3N3O/c1-3-5(2)13-8-14-6(9(10,11)12)4-7(16)15-8/h4-5H,3H2,1-2H3,(H2,13,14,15,16)/t5-/m0/s1 |
| InChIKey | LBSONGLJFZKJAP-YFKPBYRVSA-N |
| XLogP | 2.00 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |