C14H21F3N4O — CID 136741336
2-[3-(4-methylpiperidin-1-yl)propylamino]-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 136741336) has the molecular formula C14H21F3N4O and a molecular weight of 318.34 g/mol. Its IUPAC name is 2-[3-(4-methylpiperidin-1-yl)propylamino]-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[3-(4-methylpiperidin-1-yl)propylamino]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136741336 |
| Molecular Formula | C14H21F3N4O |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-[3-(4-methylpiperidin-1-yl)propylamino]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | CC1CCN(CCCNc2nc(C(F)(F)F)cc(=O)[nH]2)CC1 |
| InChI | InChI=1S/C14H21F3N4O/c1-10-3-7-21(8-4-10)6-2-5-18-13-19-11(14(15,16)17)9-12(22)20-13/h9-10H,2-8H2,1H3,(H2,18,19,20,22) |
| InChIKey | BYRLZEFGJMGIFU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|