C11H14F3N3O — CID 136741348
2-(2-methylpiperidin-1-yl)-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 136741348) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is 2-(2-methylpiperidin-1-yl)-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(2-methylpiperidin-1-yl)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136741348 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-(2-methylpiperidin-1-yl)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | CC1CCCCN1c1nc(C(F)(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C11H14F3N3O/c1-7-4-2-3-5-17(7)10-15-8(11(12,13)14)6-9(18)16-10/h6-7H,2-5H2,1H3,(H,15,16,18) |
| InChIKey | IDKJDNUYAVEKGH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |