About 2-[2,2-dimethoxyethyl(methyl)amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one
2-[2,2-dimethoxyethyl(methyl)amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 136741370) has the molecular formula C10H14F3N3O3
and a molecular weight of 281.23 g/mol. Its IUPAC name is 2-[2,2-dimethoxyethyl(methyl)amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-[2,2-dimethoxyethyl(methyl)amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| PubChem CID | 136741370 |
| Molecular Formula | C10H14F3N3O3 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-[2,2-dimethoxyethyl(methyl)amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | COC(CN(C)c1nc(C(F)(F)F)cc(=O)[nH]1)OC |
| InChI | InChI=1S/C10H14F3N3O3/c1-16(5-8(18-2)19-3)9-14-6(10(11,12)13)4-7(17)15-9/h4,8H,5H2,1-3H3,(H,14,15,17) |
| InChIKey | YYZHRROWFAYUEA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-dimethoxyethyl(methyl)amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-dimethoxyethyl(methyl)amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one?
The IUPAC name of 2-[2,2-dimethoxyethyl(methyl)amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one (CID 136741370) is 2-[2,2-dimethoxyethyl(methyl)amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one.
What is the SMILES notation for 2-[2,2-dimethoxyethyl(methyl)amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one?
The canonical SMILES for 2-[2,2-dimethoxyethyl(methyl)amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one is COC(CN(C)c1nc(C(F)(F)F)cc(=O)[nH]1)OC.
What is the InChIKey of 2-[2,2-dimethoxyethyl(methyl)amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one?
The InChIKey is YYZHRROWFAYUEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N3O3/c1-16(5-8(18-2)19-3)9-14-6(10(11,12)13)4-7(17)15-9/h4,8H,5H2,1-3H3,(H,14,15,17).
What are the key properties of 2-[2,2-dimethoxyethyl(methyl)amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one?
2-[2,2-dimethoxyethyl(methyl)amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one has a molecular weight of 281.23 g/mol, XLogP of 0.84, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-dimethoxyethyl(methyl)amino]-4-(trifluoromethyl)-1H-pyrimidin-6-one is sourced from PubChem (CID 136741370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).