C12H17F3N4O — CID 136741375
2-(2-piperidin-1-ylethylamino)-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 136741375) has the molecular formula C12H17F3N4O and a molecular weight of 290.29 g/mol. Its IUPAC name is 2-(2-piperidin-1-ylethylamino)-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(2-piperidin-1-ylethylamino)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136741375 |
| Molecular Formula | C12H17F3N4O |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-(2-piperidin-1-ylethylamino)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C(F)(F)F)nc(NCCN2CCCCC2)[nH]1 |
| InChI | InChI=1S/C12H17F3N4O/c13-12(14,15)9-8-10(20)18-11(17-9)16-4-7-19-5-2-1-3-6-19/h8H,1-7H2,(H2,16,17,18,20) |
| InChIKey | QWHPQSWXYICXMX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |