C10H13F3N4O — CID 136741437
2-(piperidin-4-ylamino)-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 136741437) has the molecular formula C10H13F3N4O and a molecular weight of 262.23 g/mol. Its IUPAC name is 2-(piperidin-4-ylamino)-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(piperidin-4-ylamino)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136741437 |
| Molecular Formula | C10H13F3N4O |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-(piperidin-4-ylamino)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C(F)(F)F)nc(NC2CCNCC2)[nH]1 |
| InChI | InChI=1S/C10H13F3N4O/c11-10(12,13)7-5-8(18)17-9(16-7)15-6-1-3-14-4-2-6/h5-6,14H,1-4H2,(H2,15,16,17,18) |
| InChIKey | CLQHPEONBQDQHM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |