C11H15F3N4O — CID 136741445
2-[4-(aminomethyl)piperidin-1-yl]-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 136741445) has the molecular formula C11H15F3N4O and a molecular weight of 276.26 g/mol. Its IUPAC name is 2-[4-(aminomethyl)piperidin-1-yl]-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[4-(aminomethyl)piperidin-1-yl]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136741445 |
| Molecular Formula | C11H15F3N4O |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-[4-(aminomethyl)piperidin-1-yl]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | NCC1CCN(c2nc(C(F)(F)F)cc(=O)[nH]2)CC1 |
| InChI | InChI=1S/C11H15F3N4O/c12-11(13,14)8-5-9(19)17-10(16-8)18-3-1-7(6-15)2-4-18/h5,7H,1-4,6,15H2,(H,16,17,19) |
| InChIKey | BDXDJWAYLGYTMX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |